Formula: Ca3U(UO2)6(CO3)2(OH)18.3-5H2O
Reflected/transmitted colour:
Pleochroism: Strong, gray (x), violet (y), lavender blue (z)
Optical isotropy/anisotropy: Biaxial
Optical sign: -
Refractive indices: α = 1.89, γ = 1.91
Bireflectance/Birefringence δ: 0.02
2V angle: 48° (measured)
Dispersion:
Optical orientation: X = c, Y = b, Z = a
Optical axial plane:
| Back to Alphabetical list | Colour photos | Physical, chemical and crystallographic description | SEM images | TEM images | vibrational spectra description | IR spectra | Raman spectra | N-IR spectra | F-IR spectra | IES spectra |