Wyartite

Formula: Ca3U(UO2)6(CO3)2(OH)18.3-5H2O

Reflected/transmitted colour:

Pleochroism: Strong, gray (x), violet (y), lavender blue (z)

Optical isotropy/anisotropy: Biaxial

Optical sign: -

Refractive indices: α = 1.89, γ = 1.91

Bireflectance/Birefringence δ: 0.02

2V angle: 48° (measured)

Dispersion:

Optical orientation: X = c, Y = b, Z = a

Optical axial plane:

 

Back to Alphabetical list Colour photos Physical, chemical and crystallographic description SEM images TEM images vibrational spectra description IR spectra Raman spectra N-IR spectra F-IR spectra IES spectra